C12H15F2NO2S — CID 3701058
1-(3,4-difluorophenyl)sulfonyl-2-methylpiperidine (PubChem CID 3701058) has the molecular formula C12H15F2NO2S and a molecular weight of 275.32 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfonyl-2-methylpiperidine.
| Compound Name | 1-(3,4-difluorophenyl)sulfonyl-2-methylpiperidine |
|---|---|
| PubChem CID | 3701058 |
| Molecular Formula | C12H15F2NO2S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfonyl-2-methylpiperidine |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H15F2NO2S/c1-9-4-2-3-7-15(9)18(16,17)10-5-6-11(13)12(14)8-10/h5-6,8-9H,2-4,7H2,1H3 |
| InChIKey | OJRLVQYJZDVURD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |