C18H20F2N2O4S2 — CID 19684545
2,5-difluoro-N-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide (PubChem CID 19684545) has the molecular formula C18H20F2N2O4S2 and a molecular weight of 430.50 g/mol. Its IUPAC name is 2,5-difluoro-N-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19684545 |
| Molecular Formula | C18H20F2N2O4S2 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | 2,5-difluoro-N-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide |
| SMILES | CC1CCCCN1S(=O)(=O)c1ccc(NS(=O)(=O)c2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C18H20F2N2O4S2/c1-13-4-2-3-11-22(13)28(25,26)16-8-6-15(7-9-16)21-27(23,24)18-12-14(19)5-10-17(18)20/h5-10,12-13,21H,2-4,11H2,1H3 |
| InChIKey | OMQCVVAREUXJRK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |