C20H26N2O6S2 — CID 19684542
3,4-dimethoxy-N-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide (PubChem CID 19684542) has the molecular formula C20H26N2O6S2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide.
| Compound Name | 3,4-dimethoxy-N-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 19684542 |
| Molecular Formula | C20H26N2O6S2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 3,4-dimethoxy-N-[4-(2-methylpiperidin-1-yl)sulfonylphenyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)N3CCCCC3C)cc2)cc1OC |
| InChI | InChI=1S/C20H26N2O6S2/c1-15-6-4-5-13-22(15)30(25,26)17-9-7-16(8-10-17)21-29(23,24)18-11-12-19(27-2)20(14-18)28-3/h7-12,14-15,21H,4-6,13H2,1-3H3 |
| InChIKey | POZBGLRWDPKQEG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |