C12H13F2NO4S — CID 43235907
1-(3,4-difluorophenyl)sulfonylpiperidine-2-carboxylic acid (PubChem CID 43235907) has the molecular formula C12H13F2NO4S and a molecular weight of 305.30 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)sulfonylpiperidine-2-carboxylic acid.
| Compound Name | 1-(3,4-difluorophenyl)sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 43235907 |
| Molecular Formula | C12H13F2NO4S |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 1-(3,4-difluorophenyl)sulfonylpiperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCCN1S(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H13F2NO4S/c13-9-5-4-8(7-10(9)14)20(18,19)15-6-2-1-3-11(15)12(16)17/h4-5,7,11H,1-3,6H2,(H,16,17) |
| InChIKey | YYHGHQYXIHEBOT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |