C12H13ClFNO4S — CID 79034860
(2R)-1-(4-chloro-2-fluorophenyl)sulfonylpiperidine-2-carboxylic acid (PubChem CID 79034860) has the molecular formula C12H13ClFNO4S and a molecular weight of 321.76 g/mol. Its IUPAC name is (2R)-1-(4-chloro-2-fluorophenyl)sulfonylpiperidine-2-carboxylic acid.
| Compound Name | (2R)-1-(4-chloro-2-fluorophenyl)sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 79034860 |
| Molecular Formula | C12H13ClFNO4S |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | (2R)-1-(4-chloro-2-fluorophenyl)sulfonylpiperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCCN1S(=O)(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H13ClFNO4S/c13-8-4-5-11(9(14)7-8)20(18,19)15-6-2-1-3-10(15)12(16)17/h4-5,7,10H,1-3,6H2,(H,16,17)/t10-/m1/s1 |
| InChIKey | NSYKZINWXLJADX-SNVBAGLBSA-N |
| XLogP | 2.11 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |