C13H13ClF3NO4S — CID 91440757
(2S)-1-[2-chloro-4-(trifluoromethyl)phenyl]sulfonylpiperidine-2-carboxylic acid (PubChem CID 91440757) has the molecular formula C13H13ClF3NO4S and a molecular weight of 371.76 g/mol. Its IUPAC name is (2S)-1-[2-chloro-4-(trifluoromethyl)phenyl]sulfonylpiperidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-chloro-4-(trifluoromethyl)phenyl]sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 91440757 |
| Molecular Formula | C13H13ClF3NO4S |
| Molecular Weight | 371.76 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | (2S)-1-[2-chloro-4-(trifluoromethyl)phenyl]sulfonylpiperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCCN1S(=O)(=O)c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H13ClF3NO4S/c14-9-7-8(13(15,16)17)4-5-11(9)23(21,22)18-6-2-1-3-10(18)12(19)20/h4-5,7,10H,1-3,6H2,(H,19,20)/t10-/m0/s1 |
| InChIKey | SGBONNFZLBXDIQ-JTQLQIEISA-N |
| XLogP | 2.99 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.76 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |