C11H11ClFNO4S — CID 103862709
(2R)-1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid (PubChem CID 103862709) has the molecular formula C11H11ClFNO4S and a molecular weight of 307.73 g/mol. Its IUPAC name is (2R)-1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 103862709 |
| Molecular Formula | C11H11ClFNO4S |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | (2R)-1-(2-chloro-5-fluorophenyl)sulfonylpyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCN1S(=O)(=O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C11H11ClFNO4S/c12-8-4-3-7(13)6-10(8)19(17,18)14-5-1-2-9(14)11(15)16/h3-4,6,9H,1-2,5H2,(H,15,16)/t9-/m1/s1 |
| InChIKey | BJVFZDRAQWCWGO-SECBINFHSA-N |
| XLogP | 1.72 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |