C13H14ClNO6S — CID 2100876
(2R)-1-(5-carboxy-2-chlorophenyl)sulfonylpiperidine-2-carboxylic acid (PubChem CID 2100876) has the molecular formula C13H14ClNO6S and a molecular weight of 347.78 g/mol. Its IUPAC name is (2R)-1-(5-carboxy-2-chlorophenyl)sulfonylpiperidine-2-carboxylic acid.
| Compound Name | (2R)-1-(5-carboxy-2-chlorophenyl)sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 2100876 |
| Molecular Formula | C13H14ClNO6S |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | (2R)-1-(5-carboxy-2-chlorophenyl)sulfonylpiperidine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(Cl)c(S(=O)(=O)N2CCCC[C@@H]2C(=O)O)c1 |
| InChI | InChI=1S/C13H14ClNO6S/c14-9-5-4-8(12(16)17)7-11(9)22(20,21)15-6-2-1-3-10(15)13(18)19/h4-5,7,10H,1-3,6H2,(H,16,17)(H,18,19)/t10-/m1/s1 |
| InChIKey | COULNJKXIDQREF-SNVBAGLBSA-N |
| XLogP | 1.67 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |