C12H10ClNO6S-2 — CID 2327746
(2R)-1-(5-carboxylato-2-chlorophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 2327746) has the molecular formula C12H10ClNO6S-2 and a molecular weight of 331.73 g/mol. Its IUPAC name is (2R)-1-(5-carboxylato-2-chlorophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | (2R)-1-(5-carboxylato-2-chlorophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 2327746 |
| Molecular Formula | C12H10ClNO6S-2 |
| Molecular Weight | 331.73 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | (2R)-1-(5-carboxylato-2-chlorophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | O=C([O-])c1ccc(Cl)c(S(=O)(=O)N2CCC[C@@H]2C(=O)[O-])c1 |
| InChI | InChI=1S/C12H12ClNO6S/c13-8-4-3-7(11(15)16)6-10(8)21(19,20)14-5-1-2-9(14)12(17)18/h3-4,6,9H,1-2,5H2,(H,15,16)(H,17,18)/p-2/t9-/m1/s1 |
| InChIKey | ZPHDYKOOUAMDKQ-SECBINFHSA-L |
| XLogP | -1.39 |
| TPSA | 117.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.73 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |