C12H11NO6S-2 — CID 3622357
1-(4-carboxylatophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 3622357) has the molecular formula C12H11NO6S-2 and a molecular weight of 297.29 g/mol. Its IUPAC name is 1-(4-carboxylatophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | 1-(4-carboxylatophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 3622357 |
| Molecular Formula | C12H11NO6S-2 |
| Molecular Weight | 297.29 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 1-(4-carboxylatophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | O=C([O-])c1ccc(S(=O)(=O)N2CCCC2C(=O)[O-])cc1 |
| InChI | InChI=1S/C12H13NO6S/c14-11(15)8-3-5-9(6-4-8)20(18,19)13-7-1-2-10(13)12(16)17/h3-6,10H,1-2,7H2,(H,14,15)(H,16,17)/p-2 |
| InChIKey | RLEDQUATDGICIA-UHFFFAOYSA-L |
| XLogP | -2.05 |
| TPSA | 117.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.29 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |