C14H21NO4S — CID 143806899
ethane;(2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid (PubChem CID 143806899) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is ethane;(2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid.
| Compound Name | ethane;(2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 143806899 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | ethane;(2S)-1-(4-methylphenyl)sulfonylpyrrolidine-2-carboxylic acid |
| SMILES | CC.Cc1ccc(S(=O)(=O)N2CCC[C@H]2C(=O)O)cc1 |
| InChI | InChI=1S/C12H15NO4S.C2H6/c1-9-4-6-10(7-5-9)18(16,17)13-8-2-3-11(13)12(14)15;1-2/h4-7,11H,2-3,8H2,1H3,(H,14,15);1-2H3/t11-;/m0./s1 |
| InChIKey | SBGGMNYKBMDLHX-MERQFXBCSA-N |
| XLogP | 2.26 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |