C14H23NO2S — CID 156877690
ethane;(2S)-2-methyl-1-(4-methylphenyl)sulfonylpyrrolidine (PubChem CID 156877690) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is ethane;(2S)-2-methyl-1-(4-methylphenyl)sulfonylpyrrolidine.
| Compound Name | ethane;(2S)-2-methyl-1-(4-methylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 156877690 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | ethane;(2S)-2-methyl-1-(4-methylphenyl)sulfonylpyrrolidine |
| SMILES | CC.Cc1ccc(S(=O)(=O)N2CCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C12H17NO2S.C2H6/c1-10-5-7-12(8-6-10)16(14,15)13-9-3-4-11(13)2;1-2/h5-8,11H,3-4,9H2,1-2H3;1-2H3/t11-;/m0./s1 |
| InChIKey | MJNDBKBMQVIPQO-MERQFXBCSA-N |
| XLogP | 3.19 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |