C13H19N3O2S — CID 144713635
N'-[4-(2-methylpyrrolidin-1-yl)sulfonylphenyl]ethanimidamide (PubChem CID 144713635) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is N'-[4-(2-methylpyrrolidin-1-yl)sulfonylphenyl]ethanimidamide.
| Compound Name | N'-[4-(2-methylpyrrolidin-1-yl)sulfonylphenyl]ethanimidamide |
|---|---|
| PubChem CID | 144713635 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N'-[4-(2-methylpyrrolidin-1-yl)sulfonylphenyl]ethanimidamide |
| SMILES | C/C(N)=N\c1ccc(S(=O)(=O)N2CCCC2C)cc1 |
| InChI | InChI=1S/C13H19N3O2S/c1-10-4-3-9-16(10)19(17,18)13-7-5-12(6-8-13)15-11(2)14/h5-8,10H,3-4,9H2,1-2H3,(H2,14,15) |
| InChIKey | FMFCDYZYNWREJE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|