C14H16NO4S- — CID 6969895
(2R)-1-(2,3-dihydro-1H-inden-5-ylsulfonyl)pyrrolidine-2-carboxylate (PubChem CID 6969895) has the molecular formula C14H16NO4S- and a molecular weight of 294.35 g/mol. Its IUPAC name is (2R)-1-(2,3-dihydro-1H-inden-5-ylsulfonyl)pyrrolidine-2-carboxylate.
| Compound Name | (2R)-1-(2,3-dihydro-1H-inden-5-ylsulfonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 6969895 |
| Molecular Formula | C14H16NO4S- |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (2R)-1-(2,3-dihydro-1H-inden-5-ylsulfonyl)pyrrolidine-2-carboxylate |
| SMILES | O=C([O-])[C@H]1CCCN1S(=O)(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H17NO4S/c16-14(17)13-5-2-8-15(13)20(18,19)12-7-6-10-3-1-4-11(10)9-12/h6-7,9,13H,1-5,8H2,(H,16,17)/p-1/t13-/m1/s1 |
| InChIKey | SKWFXMCMFQHSEZ-CYBMUJFWSA-M |
| XLogP | 0.08 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |