C12H14NO5S- — CID 2215363
(2R)-1-(3-methoxyphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 2215363) has the molecular formula C12H14NO5S- and a molecular weight of 284.31 g/mol. Its IUPAC name is (2R)-1-(3-methoxyphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | (2R)-1-(3-methoxyphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 2215363 |
| Molecular Formula | C12H14NO5S- |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | (2R)-1-(3-methoxyphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | COc1cccc(S(=O)(=O)N2CCC[C@@H]2C(=O)[O-])c1 |
| InChI | InChI=1S/C12H15NO5S/c1-18-9-4-2-5-10(8-9)19(16,17)13-7-3-6-11(13)12(14)15/h2,4-5,8,11H,3,6-7H2,1H3,(H,14,15)/p-1/t11-/m1/s1 |
| InChIKey | WAIYOLBUTQTIHL-LLVKDONJSA-M |
| XLogP | -0.40 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |