C11H13NO5S — CID 86623479
methyl 1-(3-methoxyphenyl)sulfonylaziridine-2-carboxylate (PubChem CID 86623479) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is methyl 1-(3-methoxyphenyl)sulfonylaziridine-2-carboxylate.
| Compound Name | methyl 1-(3-methoxyphenyl)sulfonylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 86623479 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | methyl 1-(3-methoxyphenyl)sulfonylaziridine-2-carboxylate |
| SMILES | COC(=O)C1CN1S(=O)(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C11H13NO5S/c1-16-8-4-3-5-9(6-8)18(14,15)12-7-10(12)11(13)17-2/h3-6,10H,7H2,1-2H3 |
| InChIKey | BFDWBQZOEQUYGT-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|