C11H10F3NO4S — CID 166643474
methyl 1-[4-(trifluoromethyl)phenyl]sulfonylaziridine-2-carboxylate (PubChem CID 166643474) has the molecular formula C11H10F3NO4S and a molecular weight of 309.27 g/mol. Its IUPAC name is methyl 1-[4-(trifluoromethyl)phenyl]sulfonylaziridine-2-carboxylate.
| Compound Name | methyl 1-[4-(trifluoromethyl)phenyl]sulfonylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 166643474 |
| Molecular Formula | C11H10F3NO4S |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | methyl 1-[4-(trifluoromethyl)phenyl]sulfonylaziridine-2-carboxylate |
| SMILES | COC(=O)C1CN1S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F3NO4S/c1-19-10(16)9-6-15(9)20(17,18)8-4-2-7(3-5-8)11(12,13)14/h2-5,9H,6H2,1H3 |
| InChIKey | FTEDZTIAKBCVLX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|