C12H15NO4S — CID 102306773
methyl (2R)-1-(4-methylphenyl)sulfonylazetidine-2-carboxylate (PubChem CID 102306773) has the molecular formula C12H15NO4S and a molecular weight of 269.32 g/mol. Its IUPAC name is methyl (2R)-1-(4-methylphenyl)sulfonylazetidine-2-carboxylate.
| Compound Name | methyl (2R)-1-(4-methylphenyl)sulfonylazetidine-2-carboxylate |
|---|---|
| PubChem CID | 102306773 |
| Molecular Formula | C12H15NO4S |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | methyl (2R)-1-(4-methylphenyl)sulfonylazetidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1CCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H15NO4S/c1-9-3-5-10(6-4-9)18(15,16)13-8-7-11(13)12(14)17-2/h3-6,11H,7-8H2,1-2H3/t11-/m1/s1 |
| InChIKey | PVBGMGZHVFMCPX-LLVKDONJSA-N |
| XLogP | 0.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |