C12H15F2NO4S — CID 144826687
methyl (2S)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylate;hydrofluoride (PubChem CID 144826687) has the molecular formula C12H15F2NO4S and a molecular weight of 307.32 g/mol. Its IUPAC name is methyl (2S)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylate;hydrofluoride.
| Compound Name | methyl (2S)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylate;hydrofluoride |
|---|---|
| PubChem CID | 144826687 |
| Molecular Formula | C12H15F2NO4S |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | methyl (2S)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylate;hydrofluoride |
| SMILES | COC(=O)[C@@H]1CCCN1S(=O)(=O)c1ccc(F)cc1.F |
| InChI | InChI=1S/C12H14FNO4S.FH/c1-18-12(15)11-3-2-8-14(11)19(16,17)10-6-4-9(13)5-7-10;/h4-7,11H,2-3,8H2,1H3;1H/t11-;/m0./s1 |
| InChIKey | ORLCHAXFUKLGHQ-MERQFXBCSA-N |
| XLogP | 1.30 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |