C18H18FNO4S — CID 110394932
[1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-(4-methoxyphenyl)methanone (PubChem CID 110394932) has the molecular formula C18H18FNO4S and a molecular weight of 363.41 g/mol. Its IUPAC name is [1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 110394932 |
| Molecular Formula | C18H18FNO4S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | [1-(4-fluorophenyl)sulfonylpyrrolidin-2-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)C2CCCN2S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H18FNO4S/c1-24-15-8-4-13(5-9-15)18(21)17-3-2-12-20(17)25(22,23)16-10-6-14(19)7-11-16/h4-11,17H,2-3,12H2,1H3 |
| InChIKey | OVBDIXMQALOCCY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |