C18H17ClFNO4S — CID 97236322
[(2S)-1-(3-chloro-4-fluorophenyl)sulfonylpyrrolidin-2-yl]-(4-methoxyphenyl)methanone (PubChem CID 97236322) has the molecular formula C18H17ClFNO4S and a molecular weight of 397.86 g/mol. Its IUPAC name is [(2S)-1-(3-chloro-4-fluorophenyl)sulfonylpyrrolidin-2-yl]-(4-methoxyphenyl)methanone.
| Compound Name | [(2S)-1-(3-chloro-4-fluorophenyl)sulfonylpyrrolidin-2-yl]-(4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 97236322 |
| Molecular Formula | C18H17ClFNO4S |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | [(2S)-1-(3-chloro-4-fluorophenyl)sulfonylpyrrolidin-2-yl]-(4-methoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)[C@@H]2CCCN2S(=O)(=O)c2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H17ClFNO4S/c1-25-13-6-4-12(5-7-13)18(22)17-3-2-10-21(17)26(23,24)14-8-9-16(20)15(19)11-14/h4-9,11,17H,2-3,10H2,1H3/t17-/m0/s1 |
| InChIKey | KGURHYNVRCVWBK-KRWDZBQOSA-N |
| XLogP | 3.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |