C18H19ClFNO4S — CID 9190208
(2S)-1-(3-chloro-4-fluorophenyl)sulfonyl-2-(2,5-dimethoxyphenyl)pyrrolidine (PubChem CID 9190208) has the molecular formula C18H19ClFNO4S and a molecular weight of 399.87 g/mol. Its IUPAC name is (2S)-1-(3-chloro-4-fluorophenyl)sulfonyl-2-(2,5-dimethoxyphenyl)pyrrolidine.
| Compound Name | (2S)-1-(3-chloro-4-fluorophenyl)sulfonyl-2-(2,5-dimethoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 9190208 |
| Molecular Formula | C18H19ClFNO4S |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | (2S)-1-(3-chloro-4-fluorophenyl)sulfonyl-2-(2,5-dimethoxyphenyl)pyrrolidine |
| SMILES | COc1ccc(OC)c([C@@H]2CCCN2S(=O)(=O)c2ccc(F)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H19ClFNO4S/c1-24-12-5-8-18(25-2)14(10-12)17-4-3-9-21(17)26(22,23)13-6-7-16(20)15(19)11-13/h5-8,10-11,17H,3-4,9H2,1-2H3/t17-/m0/s1 |
| InChIKey | RWWNPYQZNQWRKI-KRWDZBQOSA-N |
| XLogP | 4.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |