C20H25NO4S — CID 9190253
(2R)-2-(2,5-dimethoxyphenyl)-1-(4-ethylphenyl)sulfonylpyrrolidine (PubChem CID 9190253) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is (2R)-2-(2,5-dimethoxyphenyl)-1-(4-ethylphenyl)sulfonylpyrrolidine.
| Compound Name | (2R)-2-(2,5-dimethoxyphenyl)-1-(4-ethylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 9190253 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | (2R)-2-(2,5-dimethoxyphenyl)-1-(4-ethylphenyl)sulfonylpyrrolidine |
| SMILES | CCc1ccc(S(=O)(=O)N2CCC[C@@H]2c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C20H25NO4S/c1-4-15-7-10-17(11-8-15)26(22,23)21-13-5-6-19(21)18-14-16(24-2)9-12-20(18)25-3/h7-12,14,19H,4-6,13H2,1-3H3/t19-/m1/s1 |
| InChIKey | VURXGKVAOKRBAB-LJQANCHMSA-N |
| XLogP | 3.79 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |