C18H19FN2O6S — CID 9190240
(2S)-2-(2,5-dimethoxyphenyl)-1-(4-fluoro-3-nitrophenyl)sulfonylpyrrolidine (PubChem CID 9190240) has the molecular formula C18H19FN2O6S and a molecular weight of 410.42 g/mol. Its IUPAC name is (2S)-2-(2,5-dimethoxyphenyl)-1-(4-fluoro-3-nitrophenyl)sulfonylpyrrolidine.
| Compound Name | (2S)-2-(2,5-dimethoxyphenyl)-1-(4-fluoro-3-nitrophenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 9190240 |
| Molecular Formula | C18H19FN2O6S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | (2S)-2-(2,5-dimethoxyphenyl)-1-(4-fluoro-3-nitrophenyl)sulfonylpyrrolidine |
| SMILES | COc1ccc(OC)c([C@@H]2CCCN2S(=O)(=O)c2ccc(F)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C18H19FN2O6S/c1-26-12-5-8-18(27-2)14(10-12)16-4-3-9-20(16)28(24,25)13-6-7-15(19)17(11-13)21(22)23/h5-8,10-11,16H,3-4,9H2,1-2H3/t16-/m0/s1 |
| InChIKey | BJJCYVSKUMAHMD-INIZCTEOSA-N |
| XLogP | 3.28 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|