C18H28N2O4S — CID 46688857
1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]sulfonylazepane (PubChem CID 46688857) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is 1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]sulfonylazepane.
| Compound Name | 1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]sulfonylazepane |
|---|---|
| PubChem CID | 46688857 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-[2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]sulfonylazepane |
| SMILES | COc1ccc(OC)c(C2CCCN2S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C18H28N2O4S/c1-23-15-9-10-18(24-2)16(14-15)17-8-7-13-20(17)25(21,22)19-11-5-3-4-6-12-19/h9-10,14,17H,3-8,11-13H2,1-2H3 |
| InChIKey | WMRAGTSCSMMKHZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |