C18H20N2O6S — CID 17404197
2-(2,5-dimethoxyphenyl)-1-(4-nitrophenyl)sulfonylpyrrolidine (PubChem CID 17404197) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-1-(4-nitrophenyl)sulfonylpyrrolidine.
| Compound Name | 2-(2,5-dimethoxyphenyl)-1-(4-nitrophenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 17404197 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-1-(4-nitrophenyl)sulfonylpyrrolidine |
| SMILES | COc1ccc(OC)c(C2CCCN2S(=O)(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C18H20N2O6S/c1-25-14-7-10-18(26-2)16(12-14)17-4-3-11-19(17)27(23,24)15-8-5-13(6-9-15)20(21)22/h5-10,12,17H,3-4,11H2,1-2H3 |
| InChIKey | KDVDAUBAZBWTSC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|