C18H20BrNO4S — CID 17488650
1-(2-bromophenyl)sulfonyl-2-(2,5-dimethoxyphenyl)pyrrolidine (PubChem CID 17488650) has the molecular formula C18H20BrNO4S and a molecular weight of 426.33 g/mol. Its IUPAC name is 1-(2-bromophenyl)sulfonyl-2-(2,5-dimethoxyphenyl)pyrrolidine.
| Compound Name | 1-(2-bromophenyl)sulfonyl-2-(2,5-dimethoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 17488650 |
| Molecular Formula | C18H20BrNO4S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 1-(2-bromophenyl)sulfonyl-2-(2,5-dimethoxyphenyl)pyrrolidine |
| SMILES | COc1ccc(OC)c(C2CCCN2S(=O)(=O)c2ccccc2Br)c1 |
| InChI | InChI=1S/C18H20BrNO4S/c1-23-13-9-10-17(24-2)14(12-13)16-7-5-11-20(16)25(21,22)18-8-4-3-6-15(18)19/h3-4,6,8-10,12,16H,5,7,11H2,1-2H3 |
| InChIKey | KBLOYGWYNZSARB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |