C11H13FN2O3S — CID 2947537
1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 2947537) has the molecular formula C11H13FN2O3S and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 2947537 |
| Molecular Formula | C11H13FN2O3S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H13FN2O3S/c12-8-3-5-9(6-4-8)18(16,17)14-7-1-2-10(14)11(13)15/h3-6,10H,1-2,7H2,(H2,13,15) |
| InChIKey | BPYSDGKSIAXINK-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |