C11H14FN3O2S — CID 96560387
(2R)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboximidamide (PubChem CID 96560387) has the molecular formula C11H14FN3O2S and a molecular weight of 271.32 g/mol. Its IUPAC name is (2R)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboximidamide.
| Compound Name | (2R)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 96560387 |
| Molecular Formula | C11H14FN3O2S |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (2R)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboximidamide |
| SMILES | [H]/N=C(\N)[C@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FN3O2S/c12-8-3-5-9(6-4-8)18(16,17)15-7-1-2-10(15)11(13)14/h3-6,10H,1-2,7H2,(H3,13,14)/t10-/m1/s1 |
| InChIKey | MLZRRAQFOLZMFE-SNVBAGLBSA-N |
| XLogP | 0.91 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|