C14H18FN3O4S — CID 86759129
(1-aminoethylideneamino) (2S)-1-(4-fluorophenyl)sulfonylpiperidine-2-carboxylate (PubChem CID 86759129) has the molecular formula C14H18FN3O4S and a molecular weight of 343.38 g/mol. Its IUPAC name is (1-aminoethylideneamino) (2S)-1-(4-fluorophenyl)sulfonylpiperidine-2-carboxylate.
| Compound Name | (1-aminoethylideneamino) (2S)-1-(4-fluorophenyl)sulfonylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 86759129 |
| Molecular Formula | C14H18FN3O4S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (1-aminoethylideneamino) (2S)-1-(4-fluorophenyl)sulfonylpiperidine-2-carboxylate |
| SMILES | CC(N)=NOC(=O)[C@@H]1CCCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FN3O4S/c1-10(16)17-22-14(19)13-4-2-3-9-18(13)23(20,21)12-7-5-11(15)6-8-12/h5-8,13H,2-4,9H2,1H3,(H2,16,17)/t13-/m0/s1 |
| InChIKey | PLOKMPKJBVNXHW-ZDUSSCGKSA-N |
| XLogP | 1.20 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|