About [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] pyrazine-2-carboxylate
[[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] pyrazine-2-carboxylate (PubChem CID 57241586) has the molecular formula C17H18FN5O4S
and a molecular weight of 407.43 g/mol. Its IUPAC name is [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] pyrazine-2-carboxylate.
Molecular Properties
| Compound Name | [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] pyrazine-2-carboxylate |
| PubChem CID | 57241586 |
| Molecular Formula | C17H18FN5O4S |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] pyrazine-2-carboxylate |
| SMILES | NC(=NOC(=O)c1cnccn1)[C@@H]1CCCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN5O4S/c18-12-4-6-13(7-5-12)28(25,26)23-10-2-1-3-15(23)16(19)22-27-17(24)14-11-20-8-9-21-14/h4-9,11,15H,1-3,10H2,(H2,19,22)/t15-/m0/s1 |
| InChIKey | QYZFKGCTJAKODP-HNNXBMFYSA-N |
| XLogP | 1.29 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] pyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] pyrazine-2-carboxylate?
The IUPAC name of [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] pyrazine-2-carboxylate (CID 57241586) is [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] pyrazine-2-carboxylate.
What is the SMILES notation for [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] pyrazine-2-carboxylate?
The canonical SMILES for [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] pyrazine-2-carboxylate is NC(=NOC(=O)c1cnccn1)[C@@H]1CCCCN1S(=O)(=O)c1ccc(F)cc1.
What is the InChIKey of [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] pyrazine-2-carboxylate?
The InChIKey is QYZFKGCTJAKODP-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H18FN5O4S/c18-12-4-6-13(7-5-12)28(25,26)23-10-2-1-3-15(23)16(19)22-27-17(24)14-11-20-8-9-21-14/h4-9,11,15H,1-3,10H2,(H2,19,22)/t15-/m0/s1.
What are the key properties of [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] pyrazine-2-carboxylate?
[[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] pyrazine-2-carboxylate has a molecular weight of 407.43 g/mol, XLogP of 1.29, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] pyrazine-2-carboxylate is sourced from PubChem (CID 57241586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).