C15H18FNO4S — CID 90796084
1-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]butane-1,3-dione (PubChem CID 90796084) has the molecular formula C15H18FNO4S and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]butane-1,3-dione.
| Compound Name | 1-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]butane-1,3-dione |
|---|---|
| PubChem CID | 90796084 |
| Molecular Formula | C15H18FNO4S |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 1-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]butane-1,3-dione |
| SMILES | CC(=O)CC(=O)[C@@H]1CCCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H18FNO4S/c1-11(18)10-15(19)14-4-2-3-9-17(14)22(20,21)13-7-5-12(16)6-8-13/h5-8,14H,2-4,9-10H2,1H3/t14-/m0/s1 |
| InChIKey | VFRMFHLNJIFQKV-AWEZNQCLSA-N |
| XLogP | 1.92 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|