C16H21FN2O5S — CID 53263010
methyl 3-[[1-(4-fluorophenyl)sulfonylpiperidine-2-carbonyl]amino]propanoate (PubChem CID 53263010) has the molecular formula C16H21FN2O5S and a molecular weight of 372.42 g/mol. Its IUPAC name is methyl 3-[[1-(4-fluorophenyl)sulfonylpiperidine-2-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[1-(4-fluorophenyl)sulfonylpiperidine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 53263010 |
| Molecular Formula | C16H21FN2O5S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | methyl 3-[[1-(4-fluorophenyl)sulfonylpiperidine-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)C1CCCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H21FN2O5S/c1-24-15(20)9-10-18-16(21)14-4-2-3-11-19(14)25(22,23)13-7-5-12(17)6-8-13/h5-8,14H,2-4,9-11H2,1H3,(H,18,21) |
| InChIKey | IBDNOBSYOAASPQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |