C20H24FN3O6S2 — CID 43050515
1-(4-fluorophenyl)sulfonyl-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]pyrrolidine-2-carboxamide (PubChem CID 43050515) has the molecular formula C20H24FN3O6S2 and a molecular weight of 485.56 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 43050515 |
| Molecular Formula | C20H24FN3O6S2 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNC(=O)C2CCCN2S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C20H24FN3O6S2/c1-30-16-6-10-17(11-7-16)31(26,27)23-13-12-22-20(25)19-3-2-14-24(19)32(28,29)18-8-4-15(21)5-9-18/h4-11,19,23H,2-3,12-14H2,1H3,(H,22,25) |
| InChIKey | ZLEHMWVCKRWAHH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|