C21H24FN3O6S — CID 90983522
[[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] 2-[4-(hydroxymethyl)phenoxy]acetate (PubChem CID 90983522) has the molecular formula C21H24FN3O6S and a molecular weight of 465.50 g/mol. Its IUPAC name is [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] 2-[4-(hydroxymethyl)phenoxy]acetate.
| Compound Name | [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] 2-[4-(hydroxymethyl)phenoxy]acetate |
|---|---|
| PubChem CID | 90983522 |
| Molecular Formula | C21H24FN3O6S |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | [[amino-[(2S)-1-(4-fluorophenyl)sulfonylpiperidin-2-yl]methylidene]amino] 2-[4-(hydroxymethyl)phenoxy]acetate |
| SMILES | NC(=NOC(=O)COc1ccc(CO)cc1)[C@@H]1CCCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FN3O6S/c22-16-6-10-18(11-7-16)32(28,29)25-12-2-1-3-19(25)21(23)24-31-20(27)14-30-17-8-4-15(13-26)5-9-17/h4-11,19,26H,1-3,12-14H2,(H2,23,24)/t19-/m0/s1 |
| InChIKey | RIRAGIQVNJPQEG-IBGZPJMESA-N |
| XLogP | 1.76 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|