C17H17FN2O4S — CID 95899739
pyridin-2-ylmethyl (2S)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 95899739) has the molecular formula C17H17FN2O4S and a molecular weight of 364.40 g/mol. Its IUPAC name is pyridin-2-ylmethyl (2S)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | pyridin-2-ylmethyl (2S)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 95899739 |
| Molecular Formula | C17H17FN2O4S |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | pyridin-2-ylmethyl (2S)-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | O=C(OCc1ccccn1)[C@@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN2O4S/c18-13-6-8-15(9-7-13)25(22,23)20-11-3-5-16(20)17(21)24-12-14-4-1-2-10-19-14/h1-2,4,6-10,16H,3,5,11-12H2/t16-/m0/s1 |
| InChIKey | CHZUTIWATFUOPO-INIZCTEOSA-N |
| XLogP | 2.12 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |