C19H22N2O5S — CID 42578108
pyridin-2-ylmethyl 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 42578108) has the molecular formula C19H22N2O5S and a molecular weight of 390.46 g/mol. Its IUPAC name is pyridin-2-ylmethyl 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | pyridin-2-ylmethyl 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 42578108 |
| Molecular Formula | C19H22N2O5S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | pyridin-2-ylmethyl 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(C(=O)OCc3ccccn3)CC2)cc1 |
| InChI | InChI=1S/C19H22N2O5S/c1-25-17-5-7-18(8-6-17)27(23,24)21-12-9-15(10-13-21)19(22)26-14-16-4-2-3-11-20-16/h2-8,11,15H,9-10,12-14H2,1H3 |
| InChIKey | XZTVIUGSNALKKG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |