C16H19N3O4S — CID 90558874
2-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]oxypyrimidine (PubChem CID 90558874) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]oxypyrimidine.
| Compound Name | 2-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]oxypyrimidine |
|---|---|
| PubChem CID | 90558874 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]oxypyrimidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(Oc3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C16H19N3O4S/c1-22-13-3-5-15(6-4-13)24(20,21)19-11-7-14(8-12-19)23-16-17-9-2-10-18-16/h2-6,9-10,14H,7-8,11-12H2,1H3 |
| InChIKey | CPUDOHBABNRCNX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |