C18H25NO6S — CID 24557079
oxolan-2-ylmethyl 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 24557079) has the molecular formula C18H25NO6S and a molecular weight of 383.47 g/mol. Its IUPAC name is oxolan-2-ylmethyl 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | oxolan-2-ylmethyl 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 24557079 |
| Molecular Formula | C18H25NO6S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | oxolan-2-ylmethyl 1-(4-methoxyphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(C(=O)OCC3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C18H25NO6S/c1-23-15-4-6-17(7-5-15)26(21,22)19-10-8-14(9-11-19)18(20)25-13-16-3-2-12-24-16/h4-7,14,16H,2-3,8-13H2,1H3 |
| InChIKey | LTEYAAPKWXAHCS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |