C17H24N2O5S — CID 3396448
oxolan-2-ylmethyl 4-(4-methylphenyl)sulfonylpiperazine-1-carboxylate (PubChem CID 3396448) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is oxolan-2-ylmethyl 4-(4-methylphenyl)sulfonylpiperazine-1-carboxylate.
| Compound Name | oxolan-2-ylmethyl 4-(4-methylphenyl)sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 3396448 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | oxolan-2-ylmethyl 4-(4-methylphenyl)sulfonylpiperazine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)OCC3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C17H24N2O5S/c1-14-4-6-16(7-5-14)25(21,22)19-10-8-18(9-11-19)17(20)24-13-15-3-2-12-23-15/h4-7,15H,2-3,8-13H2,1H3 |
| InChIKey | ZCTZCPIHMQUFKD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |