C20H29N3O5S — CID 7964739
4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-4-oxo-N-[[(2S)-oxolan-2-yl]methyl]butanamide (PubChem CID 7964739) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is 4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-4-oxo-N-[[(2S)-oxolan-2-yl]methyl]butanamide.
| Compound Name | 4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-4-oxo-N-[[(2S)-oxolan-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 7964739 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 4-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-4-oxo-N-[[(2S)-oxolan-2-yl]methyl]butanamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)CCC(=O)NC[C@@H]3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C20H29N3O5S/c1-16-4-6-18(7-5-16)29(26,27)23-12-10-22(11-13-23)20(25)9-8-19(24)21-15-17-3-2-14-28-17/h4-7,17H,2-3,8-15H2,1H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | KQTVAPQDARKYSM-KRWDZBQOSA-N |
| XLogP | 0.90 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |