C16H21BrN2O4S — CID 78875837
1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-2-(oxolan-2-yl)ethanone (PubChem CID 78875837) has the molecular formula C16H21BrN2O4S and a molecular weight of 417.33 g/mol. Its IUPAC name is 1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-2-(oxolan-2-yl)ethanone.
| Compound Name | 1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-2-(oxolan-2-yl)ethanone |
|---|---|
| PubChem CID | 78875837 |
| Molecular Formula | C16H21BrN2O4S |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 1-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-2-(oxolan-2-yl)ethanone |
| SMILES | O=C(CC1CCCO1)N1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C16H21BrN2O4S/c17-13-3-5-15(6-4-13)24(21,22)19-9-7-18(8-10-19)16(20)12-14-2-1-11-23-14/h3-6,14H,1-2,7-12H2 |
| InChIKey | WIKNBRVNHJMATK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |