C16H24BrN2O3S+ — CID 8744750
1-(4-bromophenyl)sulfonyl-4-[[(2R)-oxan-2-yl]methyl]piperazin-4-ium (PubChem CID 8744750) has the molecular formula C16H24BrN2O3S+ and a molecular weight of 404.35 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-4-[[(2R)-oxan-2-yl]methyl]piperazin-4-ium.
| Compound Name | 1-(4-bromophenyl)sulfonyl-4-[[(2R)-oxan-2-yl]methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 8744750 |
| Molecular Formula | C16H24BrN2O3S+ |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-4-[[(2R)-oxan-2-yl]methyl]piperazin-4-ium |
| SMILES | O=S(=O)(c1ccc(Br)cc1)N1CC[NH+](C[C@H]2CCCCO2)CC1 |
| InChI | InChI=1S/C16H23BrN2O3S/c17-14-4-6-16(7-5-14)23(20,21)19-10-8-18(9-11-19)13-15-3-1-2-12-22-15/h4-7,15H,1-3,8-13H2/p+1/t15-/m1/s1 |
| InChIKey | QNCJSDRSNMFROI-OAHLLOKOSA-O |
| XLogP | 0.91 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |