C17H24BrN3O3S — CID 24525788
2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-1-piperidin-1-ylethanone (PubChem CID 24525788) has the molecular formula C17H24BrN3O3S and a molecular weight of 430.37 g/mol. Its IUPAC name is 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 24525788 |
| Molecular Formula | C17H24BrN3O3S |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 2-[4-(4-bromophenyl)sulfonylpiperazin-1-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(CN1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C17H24BrN3O3S/c18-15-4-6-16(7-5-15)25(23,24)21-12-10-19(11-13-21)14-17(22)20-8-2-1-3-9-20/h4-7H,1-3,8-14H2 |
| InChIKey | ICQGBECDPZQHMK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |