C18H28N4O5S2 — CID 55512311
3-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]sulfonylbenzenesulfonamide (PubChem CID 55512311) has the molecular formula C18H28N4O5S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 3-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]sulfonylbenzenesulfonamide.
| Compound Name | 3-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 55512311 |
| Molecular Formula | C18H28N4O5S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 3-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]sulfonylbenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(S(=O)(=O)N2CCN(CC(=O)N3CCCCCC3)CC2)c1 |
| InChI | InChI=1S/C18H28N4O5S2/c19-28(24,25)16-6-5-7-17(14-16)29(26,27)22-12-10-20(11-13-22)15-18(23)21-8-3-1-2-4-9-21/h5-7,14H,1-4,8-13,15H2,(H2,19,24,25) |
| InChIKey | MKBALFKXILXFNY-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 121.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |