C22H35N3O5S — CID 55639416
1-(azepan-1-yl)-2-[4-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonylpiperazin-1-yl]ethanone (PubChem CID 55639416) has the molecular formula C22H35N3O5S and a molecular weight of 453.61 g/mol. Its IUPAC name is 1-(azepan-1-yl)-2-[4-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 1-(azepan-1-yl)-2-[4-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55639416 |
| Molecular Formula | C22H35N3O5S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 1-(azepan-1-yl)-2-[4-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonylpiperazin-1-yl]ethanone |
| SMILES | COCCOc1ccc(S(=O)(=O)N2CCN(CC(=O)N3CCCCCC3)CC2)cc1C |
| InChI | InChI=1S/C22H35N3O5S/c1-19-17-20(7-8-21(19)30-16-15-29-2)31(27,28)25-13-11-23(12-14-25)18-22(26)24-9-5-3-4-6-10-24/h7-8,17H,3-6,9-16,18H2,1-2H3 |
| InChIKey | WFCWXZWSKMRTPL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|