C22H30N2O4S — CID 87027482
1-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-4-(4-methylphenyl)-1,4-diazepane (PubChem CID 87027482) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is 1-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-4-(4-methylphenyl)-1,4-diazepane.
| Compound Name | 1-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-4-(4-methylphenyl)-1,4-diazepane |
|---|---|
| PubChem CID | 87027482 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 1-[4-(2-methoxyethoxy)-3-methylphenyl]sulfonyl-4-(4-methylphenyl)-1,4-diazepane |
| SMILES | COCCOc1ccc(S(=O)(=O)N2CCCN(c3ccc(C)cc3)CC2)cc1C |
| InChI | InChI=1S/C22H30N2O4S/c1-18-5-7-20(8-6-18)23-11-4-12-24(14-13-23)29(25,26)21-9-10-22(19(2)17-21)28-16-15-27-3/h5-10,17H,4,11-16H2,1-3H3 |
| InChIKey | MPKCDQCHHLYHMD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|