C23H32N2O3S — CID 91669821
1-(3-methyl-4-propoxyphenyl)sulfonyl-4-(2,4,6-trimethylphenyl)piperazine (PubChem CID 91669821) has the molecular formula C23H32N2O3S and a molecular weight of 416.59 g/mol. Its IUPAC name is 1-(3-methyl-4-propoxyphenyl)sulfonyl-4-(2,4,6-trimethylphenyl)piperazine.
| Compound Name | 1-(3-methyl-4-propoxyphenyl)sulfonyl-4-(2,4,6-trimethylphenyl)piperazine |
|---|---|
| PubChem CID | 91669821 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 1-(3-methyl-4-propoxyphenyl)sulfonyl-4-(2,4,6-trimethylphenyl)piperazine |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCN(c3c(C)cc(C)cc3C)CC2)cc1C |
| InChI | InChI=1S/C23H32N2O3S/c1-6-13-28-22-8-7-21(16-18(22)3)29(26,27)25-11-9-24(10-12-25)23-19(4)14-17(2)15-20(23)5/h7-8,14-16H,6,9-13H2,1-5H3 |
| InChIKey | MFFFZOGAUBIJFL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |