C16H25NO5S2 — CID 90585261
1-(3-methyl-4-propoxyphenyl)sulfonyl-4-methylsulfonylpiperidine (PubChem CID 90585261) has the molecular formula C16H25NO5S2 and a molecular weight of 375.51 g/mol. Its IUPAC name is 1-(3-methyl-4-propoxyphenyl)sulfonyl-4-methylsulfonylpiperidine.
| Compound Name | 1-(3-methyl-4-propoxyphenyl)sulfonyl-4-methylsulfonylpiperidine |
|---|---|
| PubChem CID | 90585261 |
| Molecular Formula | C16H25NO5S2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 1-(3-methyl-4-propoxyphenyl)sulfonyl-4-methylsulfonylpiperidine |
| SMILES | CCCOc1ccc(S(=O)(=O)N2CCC(S(C)(=O)=O)CC2)cc1C |
| InChI | InChI=1S/C16H25NO5S2/c1-4-11-22-16-6-5-15(12-13(16)2)24(20,21)17-9-7-14(8-10-17)23(3,18)19/h5-6,12,14H,4,7-11H2,1-3H3 |
| InChIKey | WIHOHEJISJXPPH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |