C21H26Cl2N2O3S — CID 91670225
1-(4-butoxy-3-methylphenyl)sulfonyl-4-(3,4-dichlorophenyl)piperazine (PubChem CID 91670225) has the molecular formula C21H26Cl2N2O3S and a molecular weight of 457.42 g/mol. Its IUPAC name is 1-(4-butoxy-3-methylphenyl)sulfonyl-4-(3,4-dichlorophenyl)piperazine.
| Compound Name | 1-(4-butoxy-3-methylphenyl)sulfonyl-4-(3,4-dichlorophenyl)piperazine |
|---|---|
| PubChem CID | 91670225 |
| Molecular Formula | C21H26Cl2N2O3S |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 1-(4-butoxy-3-methylphenyl)sulfonyl-4-(3,4-dichlorophenyl)piperazine |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2CCN(c3ccc(Cl)c(Cl)c3)CC2)cc1C |
| InChI | InChI=1S/C21H26Cl2N2O3S/c1-3-4-13-28-21-8-6-18(14-16(21)2)29(26,27)25-11-9-24(10-12-25)17-5-7-19(22)20(23)15-17/h5-8,14-15H,3-4,9-13H2,1-2H3 |
| InChIKey | NETSAUHRRILHNR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|